C11H6BrN7 — CID 169346761
4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzonitrile (PubChem CID 169346761) has the molecular formula C11H6BrN7 and a molecular weight of 316.12 g/mol. Its IUPAC name is 4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzonitrile.
| Compound Name | 4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzonitrile |
|---|---|
| PubChem CID | 169346761 |
| Molecular Formula | C11H6BrN7 |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzonitrile |
| SMILES | N#CC(=CNc1cc(Br)ccc1C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C11H6BrN7/c12-9-2-1-7(4-13)10(3-9)15-6-8(5-14)11-16-18-19-17-11/h1-3,6,15H,(H,16,17,18,19) |
| InChIKey | HWIFWDNBCRVFGM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|