C13H9BrN6O2 — CID 169342974
3-[4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]prop-2-enoic acid (PubChem CID 169342974) has the molecular formula C13H9BrN6O2 and a molecular weight of 361.16 g/mol. Its IUPAC name is 3-[4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 169342974 |
| Molecular Formula | C13H9BrN6O2 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3-[4-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]prop-2-enoic acid |
| SMILES | N#CC(=CNc1cc(Br)ccc1C=CC(=O)O)c1nn[nH]n1 |
| InChI | InChI=1S/C13H9BrN6O2/c14-10-3-1-8(2-4-12(21)22)11(5-10)16-7-9(6-15)13-17-19-20-18-13/h1-5,7,16H,(H,21,22)(H,17,18,19,20) |
| InChIKey | TVFWIOHYKHCSBB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|