C20H16ClN7O — CID 169345470
N-[4-[2-(4-chlorophenyl)ethenyl]-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide (PubChem CID 169345470) has the molecular formula C20H16ClN7O and a molecular weight of 405.85 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)ethenyl]-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)ethenyl]-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 169345470 |
| Molecular Formula | C20H16ClN7O |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)ethenyl]-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=Cc2ccc(Cl)cc2)c(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C20H16ClN7O/c1-13(29)24-18-9-6-15(5-2-14-3-7-17(21)8-4-14)19(10-18)23-12-16(11-22)20-25-27-28-26-20/h2-10,12,23H,1H3,(H,24,29)(H,25,26,27,28) |
| InChIKey | UZUDBJAYQHWCMW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|