C19H20Cl2N2O2 — CID 168639493
N-[3-[(3-chloro-2-hydroxypropyl)amino]-4-[2-(4-chlorophenyl)ethenyl]phenyl]acetamide (PubChem CID 168639493) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-[3-[(3-chloro-2-hydroxypropyl)amino]-4-[2-(4-chlorophenyl)ethenyl]phenyl]acetamide.
| Compound Name | N-[3-[(3-chloro-2-hydroxypropyl)amino]-4-[2-(4-chlorophenyl)ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 168639493 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[3-[(3-chloro-2-hydroxypropyl)amino]-4-[2-(4-chlorophenyl)ethenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=Cc2ccc(Cl)cc2)c(NCC(O)CCl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-13(24)23-17-9-6-15(19(10-17)22-12-18(25)11-20)5-2-14-3-7-16(21)8-4-14/h2-10,18,22,25H,11-12H2,1H3,(H,23,24) |
| InChIKey | GHZPKISGMANIIF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|