C17H17Cl2NO7S2 — CID 168639609
5-[(3-chloro-2-hydroxypropyl)amino]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 168639609) has the molecular formula C17H17Cl2NO7S2 and a molecular weight of 482.36 g/mol. Its IUPAC name is 5-[(3-chloro-2-hydroxypropyl)amino]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168639609 |
| Molecular Formula | C17H17Cl2NO7S2 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)ccc1C=Cc1ccc(NCC(O)CCl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H17Cl2NO7S2/c18-9-15(21)10-20-14-6-4-12(17(8-14)29(25,26)27)2-1-11-3-5-13(19)7-16(11)28(22,23)24/h1-8,15,20-21H,9-10H2,(H,22,23,24)(H,25,26,27) |
| InChIKey | JSGOUAVWQURDCT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|