C18H17ClN2O4S2 — CID 168639612
2-[2-(1,3-benzothiazol-2-yl)ethenyl]-5-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid (PubChem CID 168639612) has the molecular formula C18H17ClN2O4S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)ethenyl]-5-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)ethenyl]-5-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168639612 |
| Molecular Formula | C18H17ClN2O4S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)ethenyl]-5-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(NCC(O)CCl)ccc1C=Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17ClN2O4S2/c19-10-14(22)11-20-13-7-5-12(17(9-13)27(23,24)25)6-8-18-21-15-3-1-2-4-16(15)26-18/h1-9,14,20,22H,10-11H2,(H,23,24,25) |
| InChIKey | NBWJMDIAXGKFPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|