C12H15ClN2OS — CID 168638641
1-chloro-3-[(2-ethyl-1,3-benzothiazol-6-yl)amino]propan-2-ol (PubChem CID 168638641) has the molecular formula C12H15ClN2OS and a molecular weight of 270.79 g/mol. Its IUPAC name is 1-chloro-3-[(2-ethyl-1,3-benzothiazol-6-yl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(2-ethyl-1,3-benzothiazol-6-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 168638641 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-chloro-3-[(2-ethyl-1,3-benzothiazol-6-yl)amino]propan-2-ol |
| SMILES | CCc1nc2ccc(NCC(O)CCl)cc2s1 |
| InChI | InChI=1S/C12H15ClN2OS/c1-2-12-15-10-4-3-8(5-11(10)17-12)14-7-9(16)6-13/h3-5,9,14,16H,2,6-7H2,1H3 |
| InChIKey | RRPZNWYSRWOUBP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|