C18H18ClN3S2 — CID 100567041
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea (PubChem CID 100567041) has the molecular formula C18H18ClN3S2 and a molecular weight of 375.95 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea |
|---|---|
| PubChem CID | 100567041 |
| Molecular Formula | C18H18ClN3S2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea |
| SMILES | CCc1nc2ccc(NC(=S)N[C@@H](C)c3ccc(Cl)cc3)cc2s1 |
| InChI | InChI=1S/C18H18ClN3S2/c1-3-17-22-15-9-8-14(10-16(15)24-17)21-18(23)20-11(2)12-4-6-13(19)7-5-12/h4-11H,3H2,1-2H3,(H2,20,21,23)/t11-/m0/s1 |
| InChIKey | XYPIRKOQGAOFDT-NSHDSACASA-N |
| XLogP | 5.56 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|