C19H18ClN3O2S2 — CID 100572027
(3S)-3-(3-chlorophenyl)-3-[(2-ethyl-1,3-benzothiazol-6-yl)carbamothioylamino]propanoic acid (PubChem CID 100572027) has the molecular formula C19H18ClN3O2S2 and a molecular weight of 419.96 g/mol. Its IUPAC name is (3S)-3-(3-chlorophenyl)-3-[(2-ethyl-1,3-benzothiazol-6-yl)carbamothioylamino]propanoic acid.
| Compound Name | (3S)-3-(3-chlorophenyl)-3-[(2-ethyl-1,3-benzothiazol-6-yl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 100572027 |
| Molecular Formula | C19H18ClN3O2S2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | (3S)-3-(3-chlorophenyl)-3-[(2-ethyl-1,3-benzothiazol-6-yl)carbamothioylamino]propanoic acid |
| SMILES | CCc1nc2ccc(NC(=S)N[C@@H](CC(=O)O)c3cccc(Cl)c3)cc2s1 |
| InChI | InChI=1S/C19H18ClN3O2S2/c1-2-17-22-14-7-6-13(9-16(14)27-17)21-19(26)23-15(10-18(24)25)11-4-3-5-12(20)8-11/h3-9,15H,2,10H2,1H3,(H,24,25)(H2,21,23,26)/t15-/m0/s1 |
| InChIKey | RPYPOZDPOMIYQD-HNNXBMFYSA-N |
| XLogP | 5.01 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|