C14H19N3OS2 — CID 133203198
1-(2-ethyl-1,3-benzothiazol-6-yl)-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 133203198) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 133203198 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | CCc1nc2ccc(NC(=S)NC(C)COC)cc2s1 |
| InChI | InChI=1S/C14H19N3OS2/c1-4-13-17-11-6-5-10(7-12(11)20-13)16-14(19)15-9(2)8-18-3/h5-7,9H,4,8H2,1-3H3,(H2,15,16,19) |
| InChIKey | XYWDNMAAIMKBGV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|