C18H19N3S2 — CID 100566727
1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 100566727) has the molecular formula C18H19N3S2 and a molecular weight of 341.51 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100566727 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | CCc1nc2ccc(NC(=S)N[C@@H](C)c3ccccc3)cc2s1 |
| InChI | InChI=1S/C18H19N3S2/c1-3-17-21-15-10-9-14(11-16(15)23-17)20-18(22)19-12(2)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3,(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | GSUZSMGSATVEQD-LBPRGKRZSA-N |
| XLogP | 4.91 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|