C20H23N3S2 — CID 100566959
1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea (PubChem CID 100566959) has the molecular formula C20H23N3S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea.
| Compound Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea |
|---|---|
| PubChem CID | 100566959 |
| Molecular Formula | C20H23N3S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea |
| SMILES | CCc1nc2ccc(NC(=S)N[C@H](C)CCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C20H23N3S2/c1-3-19-23-17-12-11-16(13-18(17)25-19)22-20(24)21-14(2)9-10-15-7-5-4-6-8-15/h4-8,11-14H,3,9-10H2,1-2H3,(H2,21,22,24)/t14-/m1/s1 |
| InChIKey | ZGPBUFGRZGDMPN-CQSZACIVSA-N |
| XLogP | 5.17 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|