C17H16ClN3S2 — CID 100566690
1-[(4-chlorophenyl)methyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea (PubChem CID 100566690) has the molecular formula C17H16ClN3S2 and a molecular weight of 361.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea |
|---|---|
| PubChem CID | 100566690 |
| Molecular Formula | C17H16ClN3S2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2-ethyl-1,3-benzothiazol-6-yl)thiourea |
| SMILES | CCc1nc2ccc(NC(=S)NCc3ccc(Cl)cc3)cc2s1 |
| InChI | InChI=1S/C17H16ClN3S2/c1-2-16-21-14-8-7-13(9-15(14)23-16)20-17(22)19-10-11-3-5-12(18)6-4-11/h3-9H,2,10H2,1H3,(H2,19,20,22) |
| InChIKey | PKVHOJCBHUULPG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|