C16H14ClN3S2 — CID 100559231
1-(1,2-benzothiazol-5-yl)-3-[(1R)-1-(4-chlorophenyl)ethyl]thiourea (PubChem CID 100559231) has the molecular formula C16H14ClN3S2 and a molecular weight of 347.90 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-5-yl)-3-[(1R)-1-(4-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-(1,2-benzothiazol-5-yl)-3-[(1R)-1-(4-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100559231 |
| Molecular Formula | C16H14ClN3S2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 1-(1,2-benzothiazol-5-yl)-3-[(1R)-1-(4-chlorophenyl)ethyl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc2sncc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3S2/c1-10(11-2-4-13(17)5-3-11)19-16(21)20-14-6-7-15-12(8-14)9-18-22-15/h2-10H,1H3,(H2,19,20,21)/t10-/m1/s1 |
| InChIKey | RUUBHLRMSYZESC-SNVBAGLBSA-N |
| XLogP | 5.00 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|