C21H17N3S2 — CID 100559177
1-benzhydryl-3-(1,2-benzothiazol-5-yl)thiourea (PubChem CID 100559177) has the molecular formula C21H17N3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-benzhydryl-3-(1,2-benzothiazol-5-yl)thiourea.
| Compound Name | 1-benzhydryl-3-(1,2-benzothiazol-5-yl)thiourea |
|---|---|
| PubChem CID | 100559177 |
| Molecular Formula | C21H17N3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-benzhydryl-3-(1,2-benzothiazol-5-yl)thiourea |
| SMILES | S=C(Nc1ccc2sncc2c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3S2/c25-21(23-18-11-12-19-17(13-18)14-22-26-19)24-20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,20H,(H2,23,24,25) |
| InChIKey | IGPHNNNYUJHTGH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|