C21H18F2N2S2 — CID 2434104
1-benzhydryl-3-[4-(difluoromethylsulfanyl)phenyl]thiourea (PubChem CID 2434104) has the molecular formula C21H18F2N2S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-benzhydryl-3-[4-(difluoromethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-benzhydryl-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2434104 |
| Molecular Formula | C21H18F2N2S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-benzhydryl-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18F2N2S2/c22-20(23)27-18-13-11-17(12-14-18)24-21(26)25-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19-20H,(H2,24,25,26) |
| InChIKey | YHEVAESBVDQASK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|