C21H19F2N3OS2 — CID 2477157
1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(2-methoxyanilino)phenyl]thiourea (PubChem CID 2477157) has the molecular formula C21H19F2N3OS2 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(2-methoxyanilino)phenyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(2-methoxyanilino)phenyl]thiourea |
|---|---|
| PubChem CID | 2477157 |
| Molecular Formula | C21H19F2N3OS2 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(2-methoxyanilino)phenyl]thiourea |
| SMILES | COc1ccccc1Nc1ccc(NC(=S)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H19F2N3OS2/c1-27-19-5-3-2-4-18(19)24-14-6-8-15(9-7-14)25-21(28)26-16-10-12-17(13-11-16)29-20(22)23/h2-13,20,24H,1H3,(H2,25,26,28) |
| InChIKey | HPZCTQHECYFUSN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|