C14H20F2N2S2 — CID 2319011
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea (PubChem CID 2319011) has the molecular formula C14H20F2N2S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea |
|---|---|
| PubChem CID | 2319011 |
| Molecular Formula | C14H20F2N2S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(SC(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H20F2N2S2/c1-9(14(2,3)4)17-13(19)18-10-5-7-11(8-6-10)20-12(15)16/h5-9,12H,1-4H3,(H2,17,18,19)/t9-/m0/s1 |
| InChIKey | RDIJRRGZZARMTJ-VIFPVBQESA-N |
| XLogP | 4.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|