C15H21F2N3S2 — CID 2373269
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]thiourea (PubChem CID 2373269) has the molecular formula C15H21F2N3S2 and a molecular weight of 345.48 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]thiourea |
|---|---|
| PubChem CID | 2373269 |
| Molecular Formula | C15H21F2N3S2 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]thiourea |
| SMILES | C[C@@H]1CCC[C@@H](C)N1NC(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H21F2N3S2/c1-10-4-3-5-11(2)20(10)19-15(21)18-12-6-8-13(9-7-12)22-14(16)17/h6-11,14H,3-5H2,1-2H3,(H2,18,19,21)/t10-,11-/m1/s1 |
| InChIKey | GXSXNTZRFALJLS-GHMZBOCLSA-N |
| XLogP | 4.47 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|