C15H22FN3S — CID 11928035
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 11928035) has the molecular formula C15H22FN3S and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 11928035 |
| Molecular Formula | C15H22FN3S |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NN2[C@@H](C)CCC[C@@H]2C)cc1F |
| InChI | InChI=1S/C15H22FN3S/c1-10-7-8-13(9-14(10)16)17-15(20)18-19-11(2)5-4-6-12(19)3/h7-9,11-12H,4-6H2,1-3H3,(H2,17,18,20)/t11-,12-/m0/s1 |
| InChIKey | BHWNVTDNIPCQDO-RYUDHWBXSA-N |
| XLogP | 3.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|