C15H18F2N2S2 — CID 18556406
1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea (PubChem CID 18556406) has the molecular formula C15H18F2N2S2 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 18556406 |
| Molecular Formula | C15H18F2N2S2 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)N[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C15H18F2N2S2/c16-14(17)21-12-5-3-11(4-6-12)18-15(20)19-13-8-9-1-2-10(13)7-9/h3-6,9-10,13-14H,1-2,7-8H2,(H2,18,19,20)/t9-,10-,13-/m1/s1 |
| InChIKey | PTCCYPOZTIQZLW-GIPNMCIBSA-N |
| XLogP | 4.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|