C14H16ClFN2S — CID 92511695
1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 92511695) has the molecular formula C14H16ClFN2S and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 92511695 |
| Molecular Formula | C14H16ClFN2S |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N[C@H]2C[C@H]3CC[C@@H]2C3)cc1Cl |
| InChI | InChI=1S/C14H16ClFN2S/c15-11-7-10(3-4-12(11)16)17-14(19)18-13-6-8-1-2-9(13)5-8/h3-4,7-9,13H,1-2,5-6H2,(H2,17,18,19)/t8-,9+,13-/m0/s1 |
| InChIKey | JUEAGHGVWAPYTJ-RWEMILLDSA-N |
| XLogP | 3.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|