C20H16Cl2N2S — CID 4116279
1-benzhydryl-3-(3,4-dichlorophenyl)thiourea (PubChem CID 4116279) has the molecular formula C20H16Cl2N2S and a molecular weight of 387.34 g/mol. Its IUPAC name is 1-benzhydryl-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-benzhydryl-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 4116279 |
| Molecular Formula | C20H16Cl2N2S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-benzhydryl-3-(3,4-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16Cl2N2S/c21-17-12-11-16(13-18(17)22)23-20(25)24-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H,(H2,23,24,25) |
| InChIKey | NYXJXGLOVNXBBP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|