C16H16ClFN2OS — CID 42645364
1-(3-chloro-4-fluorophenyl)-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea (PubChem CID 42645364) has the molecular formula C16H16ClFN2OS and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 42645364 |
| Molecular Formula | C16H16ClFN2OS |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc([C@@H](C)NC(=S)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16ClFN2OS/c1-10(11-3-6-13(21-2)7-4-11)19-16(22)20-12-5-8-15(18)14(17)9-12/h3-10H,1-2H3,(H2,19,20,22)/t10-/m1/s1 |
| InChIKey | DBPRNPYQZLTYIU-SNVBAGLBSA-N |
| XLogP | 4.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|