C17H16ClF3N2OS — CID 100642846
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea (PubChem CID 100642846) has the molecular formula C17H16ClF3N2OS and a molecular weight of 388.84 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100642846 |
| Molecular Formula | C17H16ClF3N2OS |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc([C@@H](C)NC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H16ClF3N2OS/c1-10(11-3-6-13(24-2)7-4-11)22-16(25)23-12-5-8-15(18)14(9-12)17(19,20)21/h3-10H,1-2H3,(H2,22,23,25)/t10-/m1/s1 |
| InChIKey | ZRYOKOGZMLTONH-SNVBAGLBSA-N |
| XLogP | 5.41 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|