C17H16N6O3S2 — CID 168604685
5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-[2-(1,3-benzothiazol-2-yl)ethenyl]benzenesulfonic acid (PubChem CID 168604685) has the molecular formula C17H16N6O3S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-[2-(1,3-benzothiazol-2-yl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-[2-(1,3-benzothiazol-2-yl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168604685 |
| Molecular Formula | C17H16N6O3S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-2-[2-(1,3-benzothiazol-2-yl)ethenyl]benzenesulfonic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(C=Cc2nc3ccccc3s2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H16N6O3S2/c18-16(19)23-17(20)21-11-7-5-10(14(9-11)28(24,25)26)6-8-15-22-12-3-1-2-4-13(12)27-15/h1-9H,(H,24,25,26)(H6,18,19,20,21,23) |
| InChIKey | WQFRYWRVRNNGBH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 170.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|