C15H14N6S — CID 168605977
2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168605977) has the molecular formula C15H14N6S and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168605977 |
| Molecular Formula | C15H14N6S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H14N6S/c16-14(17)21-15(18)19-10-7-5-9(6-8-10)13-20-11-3-1-2-4-12(11)22-13/h1-8H,(H6,16,17,18,19,21) |
| InChIKey | CRMQPZSVSFAWJC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|