C9H12ClNO5S — CID 168593744
5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonic acid (PubChem CID 168593744) has the molecular formula C9H12ClNO5S and a molecular weight of 281.72 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonic acid.
| Compound Name | 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168593744 |
| Molecular Formula | C9H12ClNO5S |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)ccc1NCC(O)CO |
| InChI | InChI=1S/C9H12ClNO5S/c10-6-1-2-8(11-4-7(13)5-12)9(3-6)17(14,15)16/h1-3,7,11-13H,4-5H2,(H,14,15,16) |
| InChIKey | YNWRMAROFBJSCD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|