C12H17ClN2O3 — CID 168597106
5-chloro-2-(2,3-dihydroxypropylamino)-N,N-dimethylbenzamide (PubChem CID 168597106) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dihydroxypropylamino)-N,N-dimethylbenzamide.
| Compound Name | 5-chloro-2-(2,3-dihydroxypropylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 168597106 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-chloro-2-(2,3-dihydroxypropylamino)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(Cl)ccc1NCC(O)CO |
| InChI | InChI=1S/C12H17ClN2O3/c1-15(2)12(18)10-5-8(13)3-4-11(10)14-6-9(17)7-16/h3-5,9,14,16-17H,6-7H2,1-2H3 |
| InChIKey | MKNYDGVHTFPVSZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |