C13H19ClN2O3 — CID 55234275
4-chloro-2-(2,2-dimethoxyethylamino)-N,N-dimethylbenzamide (PubChem CID 55234275) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethoxyethylamino)-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-(2,2-dimethoxyethylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55234275 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-chloro-2-(2,2-dimethoxyethylamino)-N,N-dimethylbenzamide |
| SMILES | COC(CNc1cc(Cl)ccc1C(=O)N(C)C)OC |
| InChI | InChI=1S/C13H19ClN2O3/c1-16(2)13(17)10-6-5-9(14)7-11(10)15-8-12(18-3)19-4/h5-7,12,15H,8H2,1-4H3 |
| InChIKey | WZVAOVUOZAHUDS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|