C16H23ClN2O — CID 43737639
4-chloro-2-(cyclohexylmethylamino)-N,N-dimethylbenzamide (PubChem CID 43737639) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 4-chloro-2-(cyclohexylmethylamino)-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-(cyclohexylmethylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43737639 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-chloro-2-(cyclohexylmethylamino)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NCC1CCCCC1 |
| InChI | InChI=1S/C16H23ClN2O/c1-19(2)16(20)14-9-8-13(17)10-15(14)18-11-12-6-4-3-5-7-12/h8-10,12,18H,3-7,11H2,1-2H3 |
| InChIKey | WRRFYTHTBJIRAL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |