C17H25ClN2O — CID 65080368
4-chloro-N,N-dimethyl-2-[(4-methylcycloheptyl)amino]benzamide (PubChem CID 65080368) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-[(4-methylcycloheptyl)amino]benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-2-[(4-methylcycloheptyl)amino]benzamide |
|---|---|
| PubChem CID | 65080368 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-[(4-methylcycloheptyl)amino]benzamide |
| SMILES | CC1CCCC(Nc2cc(Cl)ccc2C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C17H25ClN2O/c1-12-5-4-6-14(9-7-12)19-16-11-13(18)8-10-15(16)17(21)20(2)3/h8,10-12,14,19H,4-7,9H2,1-3H3 |
| InChIKey | AADZTMFDRXBUBD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |