C17H25ClN2O — CID 64763247
4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide (PubChem CID 64763247) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 64763247 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide |
| SMILES | CC1CCC(C)C(Nc2cc(Cl)ccc2C(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H25ClN2O/c1-11-5-6-12(2)15(9-11)19-16-10-13(18)7-8-14(16)17(21)20(3)4/h7-8,10-12,15,19H,5-6,9H2,1-4H3 |
| InChIKey | ZFDADCUUSOJIIQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |