About 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide
4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide (PubChem CID 64763247) has the molecular formula C17H25ClN2O
and a molecular weight of 308.85 g/mol. Its IUPAC name is 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide |
| PubChem CID | 64763247 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide |
| SMILES | CC1CCC(C)C(Nc2cc(Cl)ccc2C(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H25ClN2O/c1-11-5-6-12(2)15(9-11)19-16-10-13(18)7-8-14(16)17(21)20(3)4/h7-8,10-12,15,19H,5-6,9H2,1-4H3 |
| InChIKey | ZFDADCUUSOJIIQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide?
The IUPAC name of 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide (CID 64763247) is 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide?
The canonical SMILES for 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide is CC1CCC(C)C(Nc2cc(Cl)ccc2C(=O)N(C)C)C1.
What is the InChIKey of 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide?
The InChIKey is ZFDADCUUSOJIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O/c1-11-5-6-12(2)15(9-11)19-16-10-13(18)7-8-14(16)17(21)20(3)4/h7-8,10-12,15,19H,5-6,9H2,1-4H3.
What are the key properties of 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide?
4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide has a molecular weight of 308.85 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(2,5-dimethylcyclohexyl)amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 64763247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).