C11H12Cl2N2O2 — CID 43695965
4-chloro-2-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide (PubChem CID 43695965) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.14 g/mol. Its IUPAC name is 4-chloro-2-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43695965 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 4-chloro-2-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NC(=O)CCl |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-15(2)11(17)8-4-3-7(13)5-9(8)14-10(16)6-12/h3-5H,6H2,1-2H3,(H,14,16) |
| InChIKey | SFDCBYKRJMBRTO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|