C15H22ClN3O2 — CID 104683758
2-[(5-amino-2-methylpentanoyl)amino]-4-chloro-N,N-dimethylbenzamide (PubChem CID 104683758) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 2-[(5-amino-2-methylpentanoyl)amino]-4-chloro-N,N-dimethylbenzamide.
| Compound Name | 2-[(5-amino-2-methylpentanoyl)amino]-4-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 104683758 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(5-amino-2-methylpentanoyl)amino]-4-chloro-N,N-dimethylbenzamide |
| SMILES | CC(CCCN)C(=O)Nc1cc(Cl)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C15H22ClN3O2/c1-10(5-4-8-17)14(20)18-13-9-11(16)6-7-12(13)15(21)19(2)3/h6-7,9-10H,4-5,8,17H2,1-3H3,(H,18,20) |
| InChIKey | SHXAFFNSRIFXQU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |