C17H27ClN2O — CID 43737653
4-chloro-N,N-dimethyl-2-(octan-2-ylamino)benzamide (PubChem CID 43737653) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-(octan-2-ylamino)benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-2-(octan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 43737653 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-(octan-2-ylamino)benzamide |
| SMILES | CCCCCCC(C)Nc1cc(Cl)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C17H27ClN2O/c1-5-6-7-8-9-13(2)19-16-12-14(18)10-11-15(16)17(21)20(3)4/h10-13,19H,5-9H2,1-4H3 |
| InChIKey | POASLUCQINUWCV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|