C13H18Cl2N2O3S — CID 79556557
4-chloro-2-[(3-chloro-2-methylpropyl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 79556557) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 4-chloro-2-[(3-chloro-2-methylpropyl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-[(3-chloro-2-methylpropyl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 79556557 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-chloro-2-[(3-chloro-2-methylpropyl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1cc(Cl)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-9(7-14)8-21(19,20)16-12-6-10(15)4-5-11(12)13(18)17(2)3/h4-6,9,16H,7-8H2,1-3H3 |
| InChIKey | IFYNHCZIIIWWPK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|