C14H14BrClN2O2 — CID 43737640
2-[(5-bromofuran-2-yl)methylamino]-4-chloro-N,N-dimethylbenzamide (PubChem CID 43737640) has the molecular formula C14H14BrClN2O2 and a molecular weight of 357.64 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methylamino]-4-chloro-N,N-dimethylbenzamide.
| Compound Name | 2-[(5-bromofuran-2-yl)methylamino]-4-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43737640 |
| Molecular Formula | C14H14BrClN2O2 |
| Molecular Weight | 357.64 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methylamino]-4-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NCc1ccc(Br)o1 |
| InChI | InChI=1S/C14H14BrClN2O2/c1-18(2)14(19)11-5-3-9(16)7-12(11)17-8-10-4-6-13(15)20-10/h3-7,17H,8H2,1-2H3 |
| InChIKey | ZBQYWVGEEXOIEZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |