C13H14ClN3OS — CID 62758513
4-chloro-N,N-dimethyl-2-(1,3-thiazol-5-ylmethylamino)benzamide (PubChem CID 62758513) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-(1,3-thiazol-5-ylmethylamino)benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-2-(1,3-thiazol-5-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 62758513 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-(1,3-thiazol-5-ylmethylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NCc1cncs1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-17(2)13(18)11-4-3-9(14)5-12(11)16-7-10-6-15-8-19-10/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | MPGSAMAPMDAWPO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |