C11H11ClN2S — CID 62758474
5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 62758474) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 62758474 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | Cc1ccc(Cl)cc1NCc1cncs1 |
| InChI | InChI=1S/C11H11ClN2S/c1-8-2-3-9(12)4-11(8)14-6-10-5-13-7-15-10/h2-5,7,14H,6H2,1H3 |
| InChIKey | FPMGTZKPIGZKAX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |