C16H18ClNO — CID 28932187
4-[(5-chloro-2-methylanilino)methyl]-2,6-dimethylphenol (PubChem CID 28932187) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 4-[(5-chloro-2-methylanilino)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(5-chloro-2-methylanilino)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 28932187 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-[(5-chloro-2-methylanilino)methyl]-2,6-dimethylphenol |
| SMILES | Cc1ccc(Cl)cc1NCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C16H18ClNO/c1-10-4-5-14(17)8-15(10)18-9-13-6-11(2)16(19)12(3)7-13/h4-8,18-19H,9H2,1-3H3 |
| InChIKey | PPGGKUAWHQFBNJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |