C14H12Br2ClNO — CID 126121269
2,4-dibromo-6-[(5-chloro-2-methylanilino)methyl]phenol (PubChem CID 126121269) has the molecular formula C14H12Br2ClNO and a molecular weight of 405.52 g/mol. Its IUPAC name is 2,4-dibromo-6-[(5-chloro-2-methylanilino)methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(5-chloro-2-methylanilino)methyl]phenol |
|---|---|
| PubChem CID | 126121269 |
| Molecular Formula | C14H12Br2ClNO |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 2,4-dibromo-6-[(5-chloro-2-methylanilino)methyl]phenol |
| SMILES | Cc1ccc(Cl)cc1NCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H12Br2ClNO/c1-8-2-3-11(17)6-13(8)18-7-9-4-10(15)5-12(16)14(9)19/h2-6,18-19H,7H2,1H3 |
| InChIKey | FNUJNWHDXIEWDB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|