C10H12N4S — CID 104577485
4,6-dimethyl-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine (PubChem CID 104577485) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 4,6-dimethyl-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 104577485 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4,6-dimethyl-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCc2cncs2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-7-3-8(2)14-10(13-7)12-5-9-4-11-6-15-9/h3-4,6H,5H2,1-2H3,(H,12,13,14) |
| InChIKey | ADVNKVPOELKQIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |