C9H10N4OS — CID 104577405
4-methoxy-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine (PubChem CID 104577405) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-methoxy-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 104577405 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-methoxy-N-(1,3-thiazol-5-ylmethyl)pyrimidin-2-amine |
| SMILES | COc1ccnc(NCc2cncs2)n1 |
| InChI | InChI=1S/C9H10N4OS/c1-14-8-2-3-11-9(13-8)12-5-7-4-10-6-15-7/h2-4,6H,5H2,1H3,(H,11,12,13) |
| InChIKey | GLBNTXHKSBHBBD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |