C9H8N4O2S — CID 107554461
2-(1,3-thiazol-5-ylmethylamino)pyrimidine-4-carboxylic acid (PubChem CID 107554461) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-ylmethylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(1,3-thiazol-5-ylmethylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107554461 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(1,3-thiazol-5-ylmethylamino)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCc2cncs2)n1 |
| InChI | InChI=1S/C9H8N4O2S/c14-8(15)7-1-2-11-9(13-7)12-4-6-3-10-5-16-6/h1-3,5H,4H2,(H,14,15)(H,11,12,13) |
| InChIKey | PNHLEKAORXAFFW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |