C8H7F4N3O2 — CID 106295661
2-(2,2,3,3-tetrafluoropropylamino)pyrimidine-4-carboxylic acid (PubChem CID 106295661) has the molecular formula C8H7F4N3O2 and a molecular weight of 253.15 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106295661 |
| Molecular Formula | C8H7F4N3O2 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylamino)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H7F4N3O2/c9-6(10)8(11,12)3-14-7-13-2-1-4(15-7)5(16)17/h1-2,6H,3H2,(H,16,17)(H,13,14,15) |
| InChIKey | DLBNJTRUMWPHOM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|