C7H8F4N4 — CID 106296048
2-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine (PubChem CID 106296048) has the molecular formula C7H8F4N4 and a molecular weight of 224.16 g/mol. Its IUPAC name is 2-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106296048 |
| Molecular Formula | C7H8F4N4 |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C7H8F4N4/c8-5(9)7(10,11)3-14-6-13-2-1-4(12)15-6/h1-2,5H,3H2,(H3,12,13,14,15) |
| InChIKey | YFHRVGHWYLEPTO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|