C6H4Cl2F4N4 — CID 106293429
4,6-dichloro-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine (PubChem CID 106293429) has the molecular formula C6H4Cl2F4N4 and a molecular weight of 279.02 g/mol. Its IUPAC name is 4,6-dichloro-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106293429 |
| Molecular Formula | C6H4Cl2F4N4 |
| Molecular Weight | 279.02 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 4,6-dichloro-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)C(F)(F)CNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C6H4Cl2F4N4/c7-3-14-4(8)16-5(15-3)13-1-6(11,12)2(9)10/h2H,1H2,(H,13,14,15,16) |
| InChIKey | XUYTUTLIWBHLJS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.02 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|