C11H17F4N5O — CID 106296089
6-ethoxy-4-N-propyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 106296089) has the molecular formula C11H17F4N5O and a molecular weight of 311.28 g/mol. Its IUPAC name is 6-ethoxy-4-N-propyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-4-N-propyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106296089 |
| Molecular Formula | C11H17F4N5O |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 6-ethoxy-4-N-propyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCC(F)(F)C(F)F)nc(OCC)n1 |
| InChI | InChI=1S/C11H17F4N5O/c1-3-5-16-8-18-9(20-10(19-8)21-4-2)17-6-11(14,15)7(12)13/h7H,3-6H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | UMIFAGURBCLCAS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|