C10H15F4N5O — CID 106296113
6-ethoxy-4-N-ethyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 106296113) has the molecular formula C10H15F4N5O and a molecular weight of 297.26 g/mol. Its IUPAC name is 6-ethoxy-4-N-ethyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-4-N-ethyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106296113 |
| Molecular Formula | C10H15F4N5O |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 6-ethoxy-4-N-ethyl-2-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCC(F)(F)C(F)F)nc(OCC)n1 |
| InChI | InChI=1S/C10H15F4N5O/c1-3-15-7-17-8(19-9(18-7)20-4-2)16-5-10(13,14)6(11)12/h6H,3-5H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | BYYVUFXZDDFSRC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|